C22H29N3O7 — CID 4644706
N-cyclohexyl-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-2-(6-nitro-1,3-benzodioxol-5-yl)acetamide (PubChem CID 4644706) has the molecular formula C22H29N3O7 and a molecular weight of 447.49 g/mol. Its IUPAC name is N-cyclohexyl-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-2-(6-nitro-1,3-benzodioxol-5-yl)acetamide.
| Compound Name | N-cyclohexyl-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-2-(6-nitro-1,3-benzodioxol-5-yl)acetamide |
|---|---|
| PubChem CID | 4644706 |
| Molecular Formula | C22H29N3O7 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | N-cyclohexyl-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-2-(6-nitro-1,3-benzodioxol-5-yl)acetamide |
| SMILES | O=C(NC1CCCCC1)C(c1cc2c(cc1[N+](=O)[O-])OCO2)N1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C22H29N3O7/c26-21(23-15-4-2-1-3-5-15)20(24-8-6-22(7-9-24)31-10-11-32-22)16-12-18-19(30-14-29-18)13-17(16)25(27)28/h12-13,15,20H,1-11,14H2,(H,23,26) |
| InChIKey | PQFKJLFRQIMGLT-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 112.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|