C24H29N3O5 — CID 4644709
N-cyclohexyl-2-(N-ethyl-3-methylanilino)-2-(6-nitro-1,3-benzodioxol-5-yl)acetamide (PubChem CID 4644709) has the molecular formula C24H29N3O5 and a molecular weight of 439.51 g/mol. Its IUPAC name is N-cyclohexyl-2-(N-ethyl-3-methylanilino)-2-(6-nitro-1,3-benzodioxol-5-yl)acetamide.
| Compound Name | N-cyclohexyl-2-(N-ethyl-3-methylanilino)-2-(6-nitro-1,3-benzodioxol-5-yl)acetamide |
|---|---|
| PubChem CID | 4644709 |
| Molecular Formula | C24H29N3O5 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | N-cyclohexyl-2-(N-ethyl-3-methylanilino)-2-(6-nitro-1,3-benzodioxol-5-yl)acetamide |
| SMILES | CCN(c1cccc(C)c1)C(C(=O)NC1CCCCC1)c1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C24H29N3O5/c1-3-26(18-11-7-8-16(2)12-18)23(24(28)25-17-9-5-4-6-10-17)19-13-21-22(32-15-31-21)14-20(19)27(29)30/h7-8,11-14,17,23H,3-6,9-10,15H2,1-2H3,(H,25,28) |
| InChIKey | PXQMRTAHVVGGOA-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|