C20H29N3O7 — CID 93010694
(2R)-N-cyclohexyl-2-[2,2-dimethoxyethyl(methyl)amino]-2-(6-nitro-1,3-benzodioxol-5-yl)acetamide (PubChem CID 93010694) has the molecular formula C20H29N3O7 and a molecular weight of 423.47 g/mol. Its IUPAC name is (2R)-N-cyclohexyl-2-[2,2-dimethoxyethyl(methyl)amino]-2-(6-nitro-1,3-benzodioxol-5-yl)acetamide.
| Compound Name | (2R)-N-cyclohexyl-2-[2,2-dimethoxyethyl(methyl)amino]-2-(6-nitro-1,3-benzodioxol-5-yl)acetamide |
|---|---|
| PubChem CID | 93010694 |
| Molecular Formula | C20H29N3O7 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | (2R)-N-cyclohexyl-2-[2,2-dimethoxyethyl(methyl)amino]-2-(6-nitro-1,3-benzodioxol-5-yl)acetamide |
| SMILES | COC(CN(C)[C@@H](C(=O)NC1CCCCC1)c1cc2c(cc1[N+](=O)[O-])OCO2)OC |
| InChI | InChI=1S/C20H29N3O7/c1-22(11-18(27-2)28-3)19(20(24)21-13-7-5-4-6-8-13)14-9-16-17(30-12-29-16)10-15(14)23(25)26/h9-10,13,18-19H,4-8,11-12H2,1-3H3,(H,21,24)/t19-/m1/s1 |
| InChIKey | OTBQGMMYWYULHX-LJQANCHMSA-N |
| XLogP | 2.36 |
| TPSA | 112.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|