C13H16N2O6 — CID 171249191
methyl (3S)-3-amino-2,2-dimethyl-3-(6-nitro-1,3-benzodioxol-5-yl)propanoate (PubChem CID 171249191) has the molecular formula C13H16N2O6 and a molecular weight of 296.28 g/mol. Its IUPAC name is methyl (3S)-3-amino-2,2-dimethyl-3-(6-nitro-1,3-benzodioxol-5-yl)propanoate.
| Compound Name | methyl (3S)-3-amino-2,2-dimethyl-3-(6-nitro-1,3-benzodioxol-5-yl)propanoate |
|---|---|
| PubChem CID | 171249191 |
| Molecular Formula | C13H16N2O6 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | methyl (3S)-3-amino-2,2-dimethyl-3-(6-nitro-1,3-benzodioxol-5-yl)propanoate |
| SMILES | COC(=O)C(C)(C)[C@@H](N)c1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C13H16N2O6/c1-13(2,12(16)19-3)11(14)7-4-9-10(21-6-20-9)5-8(7)15(17)18/h4-5,11H,6,14H2,1-3H3/t11-/m0/s1 |
| InChIKey | GBVSVUPBXKXZOL-NSHDSACASA-N |
| XLogP | 1.52 |
| TPSA | 113.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|