C14H19N3O7 — CID 66786905
3,3-dimethoxy-2-(methylamino)-2-(6-nitro-1,3-benzodioxol-5-yl)butanamide (PubChem CID 66786905) has the molecular formula C14H19N3O7 and a molecular weight of 341.32 g/mol. Its IUPAC name is 3,3-dimethoxy-2-(methylamino)-2-(6-nitro-1,3-benzodioxol-5-yl)butanamide.
| Compound Name | 3,3-dimethoxy-2-(methylamino)-2-(6-nitro-1,3-benzodioxol-5-yl)butanamide |
|---|---|
| PubChem CID | 66786905 |
| Molecular Formula | C14H19N3O7 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 3,3-dimethoxy-2-(methylamino)-2-(6-nitro-1,3-benzodioxol-5-yl)butanamide |
| SMILES | CNC(C(N)=O)(c1cc2c(cc1[N+](=O)[O-])OCO2)C(C)(OC)OC |
| InChI | InChI=1S/C14H19N3O7/c1-13(21-3,22-4)14(16-2,12(15)18)8-5-10-11(24-7-23-10)6-9(8)17(19)20/h5-6,16H,7H2,1-4H3,(H2,15,18) |
| InChIKey | LVJNKGLWXDVLCH-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 135.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|