C10H12N2O4 — CID 131422553
(1R)-1-(6-nitro-1,3-benzodioxol-5-yl)propan-1-amine (PubChem CID 131422553) has the molecular formula C10H12N2O4 and a molecular weight of 224.22 g/mol. Its IUPAC name is (1R)-1-(6-nitro-1,3-benzodioxol-5-yl)propan-1-amine.
| Compound Name | (1R)-1-(6-nitro-1,3-benzodioxol-5-yl)propan-1-amine |
|---|---|
| PubChem CID | 131422553 |
| Molecular Formula | C10H12N2O4 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | (1R)-1-(6-nitro-1,3-benzodioxol-5-yl)propan-1-amine |
| SMILES | CC[C@@H](N)c1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C10H12N2O4/c1-2-7(11)6-3-9-10(16-5-15-9)4-8(6)12(13)14/h3-4,7H,2,5,11H2,1H3/t7-/m1/s1 |
| InChIKey | SYFHQTSREJZHLJ-SSDOTTSWSA-N |
| XLogP | 1.73 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|