C28H21N4O10+ — CID 11614645
(2,6-dinitrophenyl) 10-[4-(2,5-dioxopyrrolidin-1-yl)oxy-4-oxobutyl]acridin-10-ium-9-carboxylate (PubChem CID 11614645) has the molecular formula C28H21N4O10+ and a molecular weight of 573.49 g/mol. Its IUPAC name is (2,6-dinitrophenyl) 10-[4-(2,5-dioxopyrrolidin-1-yl)oxy-4-oxobutyl]acridin-10-ium-9-carboxylate.
| Compound Name | (2,6-dinitrophenyl) 10-[4-(2,5-dioxopyrrolidin-1-yl)oxy-4-oxobutyl]acridin-10-ium-9-carboxylate |
|---|---|
| PubChem CID | 11614645 |
| Molecular Formula | C28H21N4O10+ |
| Molecular Weight | 573.49 g/mol |
| Exact Mass | 573.13 |
| IUPAC Name | (2,6-dinitrophenyl) 10-[4-(2,5-dioxopyrrolidin-1-yl)oxy-4-oxobutyl]acridin-10-ium-9-carboxylate |
| SMILES | O=C(CCC[n+]1c2ccccc2c(C(=O)Oc2c([N+](=O)[O-])cccc2[N+](=O)[O-])c2ccccc21)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C28H21N4O10/c33-23-14-15-24(34)30(23)42-25(35)13-6-16-29-19-9-3-1-7-17(19)26(18-8-2-4-10-20(18)29)28(36)41-27-21(31(37)38)11-5-12-22(27)32(39)40/h1-5,7-12H,6,13-16H2/q+1 |
| InChIKey | UFPLMUQTDPGANJ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 180.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.49 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|