C12H10N2O6S2 — CID 121012277
(2,5-dioxopyrrolidin-1-yl) 2-[(2-nitrophenyl)disulfanyl]acetate (PubChem CID 121012277) has the molecular formula C12H10N2O6S2 and a molecular weight of 342.35 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[(2-nitrophenyl)disulfanyl]acetate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[(2-nitrophenyl)disulfanyl]acetate |
|---|---|
| PubChem CID | 121012277 |
| Molecular Formula | C12H10N2O6S2 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[(2-nitrophenyl)disulfanyl]acetate |
| SMILES | O=C(CSSc1ccccc1[N+](=O)[O-])ON1C(=O)CCC1=O |
| InChI | InChI=1S/C12H10N2O6S2/c15-10-5-6-11(16)13(10)20-12(17)7-21-22-9-4-2-1-3-8(9)14(18)19/h1-4H,5-7H2 |
| InChIKey | PRKGHUOCTDFYTB-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|