C13H11N5O7 — CID 10497965
(2,5-dioxopyrrolidin-1-yl) 3-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]propanoate (PubChem CID 10497965) has the molecular formula C13H11N5O7 and a molecular weight of 349.26 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]propanoate |
|---|---|
| PubChem CID | 10497965 |
| Molecular Formula | C13H11N5O7 |
| Molecular Weight | 349.26 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]propanoate |
| SMILES | O=C(CCNc1ccc([N+](=O)[O-])c2nonc12)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C13H11N5O7/c19-9-3-4-10(20)17(9)24-11(21)5-6-14-7-1-2-8(18(22)23)13-12(7)15-25-16-13/h1-2,14H,3-6H2 |
| InChIKey | WQAXPUMEDFOEST-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 157.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.26 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|