C19H16N4O5 — CID 118907048
(2,5-dioxopyrrolidin-1-yl) 2-[4-[(7-methyl-2,1,3-benzoxadiazol-4-yl)amino]phenyl]acetate (PubChem CID 118907048) has the molecular formula C19H16N4O5 and a molecular weight of 380.36 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[4-[(7-methyl-2,1,3-benzoxadiazol-4-yl)amino]phenyl]acetate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[4-[(7-methyl-2,1,3-benzoxadiazol-4-yl)amino]phenyl]acetate |
|---|---|
| PubChem CID | 118907048 |
| Molecular Formula | C19H16N4O5 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[4-[(7-methyl-2,1,3-benzoxadiazol-4-yl)amino]phenyl]acetate |
| SMILES | Cc1ccc(Nc2ccc(CC(=O)ON3C(=O)CCC3=O)cc2)c2nonc12 |
| InChI | InChI=1S/C19H16N4O5/c1-11-2-7-14(19-18(11)21-28-22-19)20-13-5-3-12(4-6-13)10-17(26)27-23-15(24)8-9-16(23)25/h2-7,20H,8-10H2,1H3 |
| InChIKey | FWZNDASGIWBUHH-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 114.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|