C22H31N3O5 — CID 167094690
(2,5-dioxopyrrolidin-1-yl) 2-[4-[4-[2-(diethylamino)ethylamino]-4-oxobutyl]phenyl]acetate (PubChem CID 167094690) has the molecular formula C22H31N3O5 and a molecular weight of 417.51 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[4-[4-[2-(diethylamino)ethylamino]-4-oxobutyl]phenyl]acetate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[4-[4-[2-(diethylamino)ethylamino]-4-oxobutyl]phenyl]acetate |
|---|---|
| PubChem CID | 167094690 |
| Molecular Formula | C22H31N3O5 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[4-[4-[2-(diethylamino)ethylamino]-4-oxobutyl]phenyl]acetate |
| SMILES | CCN(CC)CCNC(=O)CCCc1ccc(CC(=O)ON2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C22H31N3O5/c1-3-24(4-2)15-14-23-19(26)7-5-6-17-8-10-18(11-9-17)16-22(29)30-25-20(27)12-13-21(25)28/h8-11H,3-7,12-16H2,1-2H3,(H,23,26) |
| InChIKey | PWPPXTDBPUZCDY-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|