C17H25I2N5O7 — CID 135352502
(2,5-dioxopyrrolidin-1-yl) 4-[bis[2-[(2-iodoacetyl)amino]ethyl]carbamoylamino]butanoate (PubChem CID 135352502) has the molecular formula C17H25I2N5O7 and a molecular weight of 665.22 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-[bis[2-[(2-iodoacetyl)amino]ethyl]carbamoylamino]butanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-[bis[2-[(2-iodoacetyl)amino]ethyl]carbamoylamino]butanoate |
|---|---|
| PubChem CID | 135352502 |
| Molecular Formula | C17H25I2N5O7 |
| Molecular Weight | 665.22 g/mol |
| Exact Mass | 664.98 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[bis[2-[(2-iodoacetyl)amino]ethyl]carbamoylamino]butanoate |
| SMILES | O=C(CI)NCCN(CCNC(=O)CI)C(=O)NCCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C17H25I2N5O7/c18-10-12(25)20-6-8-23(9-7-21-13(26)11-19)17(30)22-5-1-2-16(29)31-24-14(27)3-4-15(24)28/h1-11H2,(H,20,25)(H,21,26)(H,22,30) |
| InChIKey | DAVFWPQOUYCXCV-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 154.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.22 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|