C13H22I2N4O5 — CID 135352491
4-[bis[2-[(2-iodoacetyl)amino]ethyl]carbamoylamino]butanoic acid (PubChem CID 135352491) has the molecular formula C13H22I2N4O5 and a molecular weight of 568.15 g/mol. Its IUPAC name is 4-[bis[2-[(2-iodoacetyl)amino]ethyl]carbamoylamino]butanoic acid.
| Compound Name | 4-[bis[2-[(2-iodoacetyl)amino]ethyl]carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 135352491 |
| Molecular Formula | C13H22I2N4O5 |
| Molecular Weight | 568.15 g/mol |
| Exact Mass | 567.97 |
| IUPAC Name | 4-[bis[2-[(2-iodoacetyl)amino]ethyl]carbamoylamino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)N(CCNC(=O)CI)CCNC(=O)CI |
| InChI | InChI=1S/C13H22I2N4O5/c14-8-10(20)16-4-6-19(7-5-17-11(21)9-15)13(24)18-3-1-2-12(22)23/h1-9H2,(H,16,20)(H,17,21)(H,18,24)(H,22,23) |
| InChIKey | ALVAMZVUJDYIPM-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.15 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|