C21H19NO5 — CID 146639752
(2,5-dioxopyrrolidin-1-yl) 2-[4-[(E)-2-(4-hydroxy-3-methylphenyl)ethenyl]phenyl]acetate (PubChem CID 146639752) has the molecular formula C21H19NO5 and a molecular weight of 365.39 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[4-[(E)-2-(4-hydroxy-3-methylphenyl)ethenyl]phenyl]acetate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[4-[(E)-2-(4-hydroxy-3-methylphenyl)ethenyl]phenyl]acetate |
|---|---|
| PubChem CID | 146639752 |
| Molecular Formula | C21H19NO5 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[4-[(E)-2-(4-hydroxy-3-methylphenyl)ethenyl]phenyl]acetate |
| SMILES | Cc1cc(/C=C/c2ccc(CC(=O)ON3C(=O)CCC3=O)cc2)ccc1O |
| InChI | InChI=1S/C21H19NO5/c1-14-12-16(8-9-18(14)23)5-2-15-3-6-17(7-4-15)13-21(26)27-22-19(24)10-11-20(22)25/h2-9,12,23H,10-11,13H2,1H3/b5-2+ |
| InChIKey | OAYIXYBWEFDOPH-GORDUTHDSA-N |
| XLogP | 3.02 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|