C18H24NO4S+ — CID 143652418
[3-[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethyl]phenyl]-di(propan-2-yl)sulfanium (PubChem CID 143652418) has the molecular formula C18H24NO4S+ and a molecular weight of 350.46 g/mol. Its IUPAC name is [3-[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethyl]phenyl]-di(propan-2-yl)sulfanium.
| Compound Name | [3-[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethyl]phenyl]-di(propan-2-yl)sulfanium |
|---|---|
| PubChem CID | 143652418 |
| Molecular Formula | C18H24NO4S+ |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | [3-[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethyl]phenyl]-di(propan-2-yl)sulfanium |
| SMILES | CC(C)[S+](c1cccc(CC(=O)ON2C(=O)CCC2=O)c1)C(C)C |
| InChI | InChI=1S/C18H24NO4S/c1-12(2)24(13(3)4)15-7-5-6-14(10-15)11-18(22)23-19-16(20)8-9-17(19)21/h5-7,10,12-13H,8-9,11H2,1-4H3/q+1 |
| InChIKey | FOFLAYNVYYROKZ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|