C26H23NO6 — CID 11732990
(2,5-dioxopyrrolidin-1-yl) 2-[2,4-bis(phenylmethoxy)phenyl]acetate (PubChem CID 11732990) has the molecular formula C26H23NO6 and a molecular weight of 445.47 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[2,4-bis(phenylmethoxy)phenyl]acetate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[2,4-bis(phenylmethoxy)phenyl]acetate |
|---|---|
| PubChem CID | 11732990 |
| Molecular Formula | C26H23NO6 |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[2,4-bis(phenylmethoxy)phenyl]acetate |
| SMILES | O=C(Cc1ccc(OCc2ccccc2)cc1OCc1ccccc1)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C26H23NO6/c28-24-13-14-25(29)27(24)33-26(30)15-21-11-12-22(31-17-19-7-3-1-4-8-19)16-23(21)32-18-20-9-5-2-6-10-20/h1-12,16H,13-15,17-18H2 |
| InChIKey | IFFXHBDFLGFIRU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|