C15H17NO4S — CID 155271019
(2,5-dioxopyrrolidin-1-yl) 2-(2-propan-2-ylphenyl)sulfanylacetate (PubChem CID 155271019) has the molecular formula C15H17NO4S and a molecular weight of 307.37 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-(2-propan-2-ylphenyl)sulfanylacetate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-(2-propan-2-ylphenyl)sulfanylacetate |
|---|---|
| PubChem CID | 155271019 |
| Molecular Formula | C15H17NO4S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-(2-propan-2-ylphenyl)sulfanylacetate |
| SMILES | CC(C)c1ccccc1SCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C15H17NO4S/c1-10(2)11-5-3-4-6-12(11)21-9-15(19)20-16-13(17)7-8-14(16)18/h3-6,10H,7-9H2,1-2H3 |
| InChIKey | KZUJJLABFWLSLP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|