C9H15BrN2O4 — CID 71752826
[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethyl]-trimethylazanium bromide (PubChem CID 71752826) has the molecular formula C9H15BrN2O4 and a molecular weight of 295.13 g/mol. Its IUPAC name is [2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethyl]-trimethylazanium bromide.
| Compound Name | [2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethyl]-trimethylazanium bromide |
|---|---|
| PubChem CID | 71752826 |
| Molecular Formula | C9H15BrN2O4 |
| Molecular Weight | 295.13 g/mol |
| Exact Mass | 294.02 |
| IUPAC Name | [2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethyl]-trimethylazanium bromide |
| SMILES | C[N+](C)(C)CC(=O)ON1C(=O)CCC1=O.[Br-] |
| InChI | InChI=1S/C9H15N2O4.BrH/c1-11(2,3)6-9(14)15-10-7(12)4-5-8(10)13;/h4-6H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | HERFXNCAXJIPGV-UHFFFAOYSA-M |
| XLogP | -3.70 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.13 |
| LogP ≤ 5 | -3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|