C10H15NO5S — CID 10659065
(2,5-dioxopyrrolidin-1-yl) 2-(1-ethoxyethylsulfanyl)acetate (PubChem CID 10659065) has the molecular formula C10H15NO5S and a molecular weight of 261.30 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-(1-ethoxyethylsulfanyl)acetate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-(1-ethoxyethylsulfanyl)acetate |
|---|---|
| PubChem CID | 10659065 |
| Molecular Formula | C10H15NO5S |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-(1-ethoxyethylsulfanyl)acetate |
| SMILES | CCOC(C)SCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C10H15NO5S/c1-3-15-7(2)17-6-10(14)16-11-8(12)4-5-9(11)13/h7H,3-6H2,1-2H3 |
| InChIKey | MGNXBHPHCKAJKU-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|