C20H20N2O4 — CID 89059403
(2,5-dioxopyrrolidin-1-yl) 2-[2-(2,3-dimethylanilino)phenyl]acetate (PubChem CID 89059403) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[2-(2,3-dimethylanilino)phenyl]acetate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[2-(2,3-dimethylanilino)phenyl]acetate |
|---|---|
| PubChem CID | 89059403 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[2-(2,3-dimethylanilino)phenyl]acetate |
| SMILES | Cc1cccc(Nc2ccccc2CC(=O)ON2C(=O)CCC2=O)c1C |
| InChI | InChI=1S/C20H20N2O4/c1-13-6-5-9-16(14(13)2)21-17-8-4-3-7-15(17)12-20(25)26-22-18(23)10-11-19(22)24/h3-9,21H,10-12H2,1-2H3 |
| InChIKey | MXLDIXNBIORSFW-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|