C23H25N3O3 — CID 163928985
ethyl 2-[1-benzyl-2-(2,3-dimethylanilino)-4-oxopyrimidin-5-yl]acetate (PubChem CID 163928985) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is ethyl 2-[1-benzyl-2-(2,3-dimethylanilino)-4-oxopyrimidin-5-yl]acetate.
| Compound Name | ethyl 2-[1-benzyl-2-(2,3-dimethylanilino)-4-oxopyrimidin-5-yl]acetate |
|---|---|
| PubChem CID | 163928985 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | ethyl 2-[1-benzyl-2-(2,3-dimethylanilino)-4-oxopyrimidin-5-yl]acetate |
| SMILES | CCOC(=O)Cc1cn(Cc2ccccc2)c(Nc2cccc(C)c2C)nc1=O |
| InChI | InChI=1S/C23H25N3O3/c1-4-29-21(27)13-19-15-26(14-18-10-6-5-7-11-18)23(25-22(19)28)24-20-12-8-9-16(2)17(20)3/h5-12,15H,4,13-14H2,1-3H3,(H,24,25,28) |
| InChIKey | RHBCFACRVPYEAA-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |