C23H23ClN4O3 — CID 134291313
2-[1-benzyl-2-(3-chloro-2-methylanilino)-4-oxopyrimidin-5-yl]-N-(oxetan-3-yl)acetamide (PubChem CID 134291313) has the molecular formula C23H23ClN4O3 and a molecular weight of 438.92 g/mol. Its IUPAC name is 2-[1-benzyl-2-(3-chloro-2-methylanilino)-4-oxopyrimidin-5-yl]-N-(oxetan-3-yl)acetamide.
| Compound Name | 2-[1-benzyl-2-(3-chloro-2-methylanilino)-4-oxopyrimidin-5-yl]-N-(oxetan-3-yl)acetamide |
|---|---|
| PubChem CID | 134291313 |
| Molecular Formula | C23H23ClN4O3 |
| Molecular Weight | 438.92 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 2-[1-benzyl-2-(3-chloro-2-methylanilino)-4-oxopyrimidin-5-yl]-N-(oxetan-3-yl)acetamide |
| SMILES | Cc1c(Cl)cccc1Nc1nc(=O)c(CC(=O)NC2COC2)cn1Cc1ccccc1 |
| InChI | InChI=1S/C23H23ClN4O3/c1-15-19(24)8-5-9-20(15)26-23-27-22(30)17(10-21(29)25-18-13-31-14-18)12-28(23)11-16-6-3-2-4-7-16/h2-9,12,18H,10-11,13-14H2,1H3,(H,25,29)(H,26,27,30) |
| InChIKey | XYWNTQFBWAVGQJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.92 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |