C22H14N4O12S2 — CID 59806893
(2,5-dioxopyrrolidin-1-yl) 2-[[2-(2,5-dioxopyrrolidin-1-yl)oxycarbonyl-4-nitrophenyl]disulfanyl]-5-nitrobenzoate (PubChem CID 59806893) has the molecular formula C22H14N4O12S2 and a molecular weight of 590.50 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[[2-(2,5-dioxopyrrolidin-1-yl)oxycarbonyl-4-nitrophenyl]disulfanyl]-5-nitrobenzoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[[2-(2,5-dioxopyrrolidin-1-yl)oxycarbonyl-4-nitrophenyl]disulfanyl]-5-nitrobenzoate |
|---|---|
| PubChem CID | 59806893 |
| Molecular Formula | C22H14N4O12S2 |
| Molecular Weight | 590.50 g/mol |
| Exact Mass | 590.00 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[[2-(2,5-dioxopyrrolidin-1-yl)oxycarbonyl-4-nitrophenyl]disulfanyl]-5-nitrobenzoate |
| SMILES | O=C(ON1C(=O)CCC1=O)c1cc([N+](=O)[O-])ccc1SSc1ccc([N+](=O)[O-])cc1C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C22H14N4O12S2/c27-17-5-6-18(28)23(17)37-21(31)13-9-11(25(33)34)1-3-15(13)39-40-16-4-2-12(26(35)36)10-14(16)22(32)38-24-19(29)7-8-20(24)30/h1-4,9-10H,5-8H2 |
| InChIKey | CDIRVSUVGRYMHW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 213.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.50 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|