C12H8N2O8 — CID 142632601
3-(2,5-dioxopyrrolidin-1-yl)oxycarbonyl-5-nitrobenzoic acid (PubChem CID 142632601) has the molecular formula C12H8N2O8 and a molecular weight of 308.20 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrolidin-1-yl)oxycarbonyl-5-nitrobenzoic acid.
| Compound Name | 3-(2,5-dioxopyrrolidin-1-yl)oxycarbonyl-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 142632601 |
| Molecular Formula | C12H8N2O8 |
| Molecular Weight | 308.20 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | 3-(2,5-dioxopyrrolidin-1-yl)oxycarbonyl-5-nitrobenzoic acid |
| SMILES | O=C(O)c1cc(C(=O)ON2C(=O)CCC2=O)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H8N2O8/c15-9-1-2-10(16)13(9)22-12(19)7-3-6(11(17)18)4-8(5-7)14(20)21/h3-5H,1-2H2,(H,17,18) |
| InChIKey | INJKEOJWENMTRJ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 144.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.20 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|