C23H26N4O10 — CID 161316343
methyl 3-morpholin-4-yl-5-nitrobenzoate;3-morpholin-4-yl-5-nitrobenzoic acid (PubChem CID 161316343) has the molecular formula C23H26N4O10 and a molecular weight of 518.48 g/mol. Its IUPAC name is methyl 3-morpholin-4-yl-5-nitrobenzoate;3-morpholin-4-yl-5-nitrobenzoic acid.
| Compound Name | methyl 3-morpholin-4-yl-5-nitrobenzoate;3-morpholin-4-yl-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 161316343 |
| Molecular Formula | C23H26N4O10 |
| Molecular Weight | 518.48 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | methyl 3-morpholin-4-yl-5-nitrobenzoate;3-morpholin-4-yl-5-nitrobenzoic acid |
| SMILES | COC(=O)c1cc(N2CCOCC2)cc([N+](=O)[O-])c1.O=C(O)c1cc(N2CCOCC2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H14N2O5.C11H12N2O5/c1-18-12(15)9-6-10(8-11(7-9)14(16)17)13-2-4-19-5-3-13;14-11(15)8-5-9(7-10(6-8)13(16)17)12-1-3-18-4-2-12/h6-8H,2-5H2,1H3;5-7H,1-4H2,(H,14,15) |
| InChIKey | VJNWWVPKPUTGJV-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 174.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.48 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|