C17H14N2O8 — CID 168646415
3-[2,3-bis(methoxycarbonyl)azepin-1-yl]-5-nitrobenzoic acid (PubChem CID 168646415) has the molecular formula C17H14N2O8 and a molecular weight of 374.31 g/mol. Its IUPAC name is 3-[2,3-bis(methoxycarbonyl)azepin-1-yl]-5-nitrobenzoic acid.
| Compound Name | 3-[2,3-bis(methoxycarbonyl)azepin-1-yl]-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 168646415 |
| Molecular Formula | C17H14N2O8 |
| Molecular Weight | 374.31 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 3-[2,3-bis(methoxycarbonyl)azepin-1-yl]-5-nitrobenzoic acid |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cc(C(=O)O)cc([N+](=O)[O-])c2)C=CC=C1 |
| InChI | InChI=1S/C17H14N2O8/c1-26-16(22)13-5-3-4-6-18(14(13)17(23)27-2)11-7-10(15(20)21)8-12(9-11)19(24)25/h3-9H,1-2H3,(H,20,21) |
| InChIKey | YDAAPKPRTZIMDI-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 136.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.31 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|