C19H21NO7 — CID 168600990
dimethyl 1-(3,4,5-trimethoxyphenyl)azepine-2,3-dicarboxylate (PubChem CID 168600990) has the molecular formula C19H21NO7 and a molecular weight of 375.38 g/mol. Its IUPAC name is dimethyl 1-(3,4,5-trimethoxyphenyl)azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-(3,4,5-trimethoxyphenyl)azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168600990 |
| Molecular Formula | C19H21NO7 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | dimethyl 1-(3,4,5-trimethoxyphenyl)azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cc(OC)c(OC)c(OC)c2)C=CC=C1 |
| InChI | InChI=1S/C19H21NO7/c1-23-14-10-12(11-15(24-2)17(14)25-3)20-9-7-6-8-13(18(21)26-4)16(20)19(22)27-5/h6-11H,1-5H3 |
| InChIKey | ZYYXTPHTBUYHLP-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |