C19H19NO6 — CID 168647198
dimethyl 1-(5-acetyl-2-methoxyphenyl)azepine-2,3-dicarboxylate (PubChem CID 168647198) has the molecular formula C19H19NO6 and a molecular weight of 357.36 g/mol. Its IUPAC name is dimethyl 1-(5-acetyl-2-methoxyphenyl)azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-(5-acetyl-2-methoxyphenyl)azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168647198 |
| Molecular Formula | C19H19NO6 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | dimethyl 1-(5-acetyl-2-methoxyphenyl)azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cc(C(C)=O)ccc2OC)C=CC=C1 |
| InChI | InChI=1S/C19H19NO6/c1-12(21)13-8-9-16(24-2)15(11-13)20-10-6-5-7-14(18(22)25-3)17(20)19(23)26-4/h5-11H,1-4H3 |
| InChIKey | MXARATXZRKSBPB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |