C19H20N2O6 — CID 168650436
dimethyl 1-(5-acetamido-2-methoxyphenyl)azepine-2,3-dicarboxylate (PubChem CID 168650436) has the molecular formula C19H20N2O6 and a molecular weight of 372.38 g/mol. Its IUPAC name is dimethyl 1-(5-acetamido-2-methoxyphenyl)azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-(5-acetamido-2-methoxyphenyl)azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168650436 |
| Molecular Formula | C19H20N2O6 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | dimethyl 1-(5-acetamido-2-methoxyphenyl)azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cc(NC(C)=O)ccc2OC)C=CC=C1 |
| InChI | InChI=1S/C19H20N2O6/c1-12(22)20-13-8-9-16(25-2)15(11-13)21-10-6-5-7-14(18(23)26-3)17(21)19(24)27-4/h5-11H,1-4H3,(H,20,22) |
| InChIKey | YMMMUDIKQYBEGX-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |