C17H17NO5 — CID 168650637
dimethyl 1-(2-hydroxy-4-methylphenyl)azepine-2,3-dicarboxylate (PubChem CID 168650637) has the molecular formula C17H17NO5 and a molecular weight of 315.33 g/mol. Its IUPAC name is dimethyl 1-(2-hydroxy-4-methylphenyl)azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-(2-hydroxy-4-methylphenyl)azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168650637 |
| Molecular Formula | C17H17NO5 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | dimethyl 1-(2-hydroxy-4-methylphenyl)azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(C)cc2O)C=CC=C1 |
| InChI | InChI=1S/C17H17NO5/c1-11-7-8-13(14(19)10-11)18-9-5-4-6-12(16(20)22-2)15(18)17(21)23-3/h4-10,19H,1-3H3 |
| InChIKey | GJXJAQBRJKAPQJ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |