C24H21NO6 — CID 168646570
2-[2,3-bis(methoxycarbonyl)azepin-1-yl]-5-(4-methylphenyl)benzoic acid (PubChem CID 168646570) has the molecular formula C24H21NO6 and a molecular weight of 419.43 g/mol. Its IUPAC name is 2-[2,3-bis(methoxycarbonyl)azepin-1-yl]-5-(4-methylphenyl)benzoic acid.
| Compound Name | 2-[2,3-bis(methoxycarbonyl)azepin-1-yl]-5-(4-methylphenyl)benzoic acid |
|---|---|
| PubChem CID | 168646570 |
| Molecular Formula | C24H21NO6 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 2-[2,3-bis(methoxycarbonyl)azepin-1-yl]-5-(4-methylphenyl)benzoic acid |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(-c3ccc(C)cc3)cc2C(=O)O)C=CC=C1 |
| InChI | InChI=1S/C24H21NO6/c1-15-7-9-16(10-8-15)17-11-12-20(19(14-17)22(26)27)25-13-5-4-6-18(23(28)30-2)21(25)24(29)31-3/h4-14H,1-3H3,(H,26,27) |
| InChIKey | MJYFHUVYYFIEMF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |