C18H14F3NO6 — CID 168646387
4-[2,3-bis(methoxycarbonyl)azepin-1-yl]-3-(trifluoromethyl)benzoic acid (PubChem CID 168646387) has the molecular formula C18H14F3NO6 and a molecular weight of 397.31 g/mol. Its IUPAC name is 4-[2,3-bis(methoxycarbonyl)azepin-1-yl]-3-(trifluoromethyl)benzoic acid.
| Compound Name | 4-[2,3-bis(methoxycarbonyl)azepin-1-yl]-3-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 168646387 |
| Molecular Formula | C18H14F3NO6 |
| Molecular Weight | 397.31 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | 4-[2,3-bis(methoxycarbonyl)azepin-1-yl]-3-(trifluoromethyl)benzoic acid |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(C(=O)O)cc2C(F)(F)F)C=CC=C1 |
| InChI | InChI=1S/C18H14F3NO6/c1-27-16(25)11-5-3-4-8-22(14(11)17(26)28-2)13-7-6-10(15(23)24)9-12(13)18(19,20)21/h3-9H,1-2H3,(H,23,24) |
| InChIKey | ARVGZKBJSYGTJN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |