C20H23NO4 — CID 168646003
dimethyl 1-(2-tert-butylphenyl)azepine-2,3-dicarboxylate (PubChem CID 168646003) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is dimethyl 1-(2-tert-butylphenyl)azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-(2-tert-butylphenyl)azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168646003 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | dimethyl 1-(2-tert-butylphenyl)azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccccc2C(C)(C)C)C=CC=C1 |
| InChI | InChI=1S/C20H23NO4/c1-20(2,3)15-11-6-7-12-16(15)21-13-9-8-10-14(18(22)24-4)17(21)19(23)25-5/h6-13H,1-5H3 |
| InChIKey | AHWOKJYEIPRLNO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |