C31H29NO5 — CID 168648116
dimethyl 1-[2-[hydroxy-bis(4-methylphenyl)methyl]phenyl]azepine-2,3-dicarboxylate (PubChem CID 168648116) has the molecular formula C31H29NO5 and a molecular weight of 495.58 g/mol. Its IUPAC name is dimethyl 1-[2-[hydroxy-bis(4-methylphenyl)methyl]phenyl]azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-[2-[hydroxy-bis(4-methylphenyl)methyl]phenyl]azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168648116 |
| Molecular Formula | C31H29NO5 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | dimethyl 1-[2-[hydroxy-bis(4-methylphenyl)methyl]phenyl]azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccccc2C(O)(c2ccc(C)cc2)c2ccc(C)cc2)C=CC=C1 |
| InChI | InChI=1S/C31H29NO5/c1-21-12-16-23(17-13-21)31(35,24-18-14-22(2)15-19-24)26-10-5-6-11-27(26)32-20-8-7-9-25(29(33)36-3)28(32)30(34)37-4/h5-20,35H,1-4H3 |
| InChIKey | MQRIQIKDPISUMB-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|