About dimethyl 1-[2-[hydroxy-bis(4-methylphenyl)methyl]phenyl]azepine-2,3-dicarboxylate
dimethyl 1-[2-[hydroxy-bis(4-methylphenyl)methyl]phenyl]azepine-2,3-dicarboxylate (PubChem CID 168648116) has the molecular formula C31H29NO5
and a molecular weight of 495.58 g/mol. Its IUPAC name is dimethyl 1-[2-[hydroxy-bis(4-methylphenyl)methyl]phenyl]azepine-2,3-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 1-[2-[hydroxy-bis(4-methylphenyl)methyl]phenyl]azepine-2,3-dicarboxylate |
| PubChem CID | 168648116 |
| Molecular Formula | C31H29NO5 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | dimethyl 1-[2-[hydroxy-bis(4-methylphenyl)methyl]phenyl]azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccccc2C(O)(c2ccc(C)cc2)c2ccc(C)cc2)C=CC=C1 |
| InChI | InChI=1S/C31H29NO5/c1-21-12-16-23(17-13-21)31(35,24-18-14-22(2)15-19-24)26-10-5-6-11-27(26)32-20-8-7-9-25(29(33)36-3)28(32)30(34)37-4/h5-20,35H,1-4H3 |
| InChIKey | MQRIQIKDPISUMB-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 1-[2-[hydroxy-bis(4-methylphenyl)methyl]phenyl]azepine-2,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 1-[2-[hydroxy-bis(4-methylphenyl)methyl]phenyl]azepine-2,3-dicarboxylate?
The IUPAC name of dimethyl 1-[2-[hydroxy-bis(4-methylphenyl)methyl]phenyl]azepine-2,3-dicarboxylate (CID 168648116) is dimethyl 1-[2-[hydroxy-bis(4-methylphenyl)methyl]phenyl]azepine-2,3-dicarboxylate.
What is the SMILES notation for dimethyl 1-[2-[hydroxy-bis(4-methylphenyl)methyl]phenyl]azepine-2,3-dicarboxylate?
The canonical SMILES for dimethyl 1-[2-[hydroxy-bis(4-methylphenyl)methyl]phenyl]azepine-2,3-dicarboxylate is COC(=O)C1=C(C(=O)OC)N(c2ccccc2C(O)(c2ccc(C)cc2)c2ccc(C)cc2)C=CC=C1.
What is the InChIKey of dimethyl 1-[2-[hydroxy-bis(4-methylphenyl)methyl]phenyl]azepine-2,3-dicarboxylate?
The InChIKey is MQRIQIKDPISUMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H29NO5/c1-21-12-16-23(17-13-21)31(35,24-18-14-22(2)15-19-24)26-10-5-6-11-27(26)32-20-8-7-9-25(29(33)36-3)28(32)30(34)37-4/h5-20,35H,1-4H3.
What are the key properties of dimethyl 1-[2-[hydroxy-bis(4-methylphenyl)methyl]phenyl]azepine-2,3-dicarboxylate?
dimethyl 1-[2-[hydroxy-bis(4-methylphenyl)methyl]phenyl]azepine-2,3-dicarboxylate has a molecular weight of 495.58 g/mol, XLogP of 5.08, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 1-[2-[hydroxy-bis(4-methylphenyl)methyl]phenyl]azepine-2,3-dicarboxylate is sourced from PubChem (CID 168648116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).