2-[2,3-bis(methoxycarbonyl)azepin-1-yl]-6-hydroxybenzoic acid

C17H15NO7 — CID 168650283

IUPAC2-[2,3-bis(methoxycarbonyl)azepin-1-yl]-6-hydroxybenzoic acid
SMILESCOC(=O)C1=C(C(=O)OC)N(c2cccc(O)c2C(=O)O)C=CC=C1
InChIInChI=1S/C17H15NO7/c1-24-16(22)10-6-3-4-9-18(14(10)17(23)25-2)11-7-5-8-12(19)13(11)15(20)21/h3-9,19H,1-2H3,(H,20,21)
InChIKeyCGFWCPGROQJQTD-UHFFFAOYSA-N
MW345.31 g/mol
LogP1.58
Rot. Bonds4

About 2-[2,3-bis(methoxycarbonyl)azepin-1-yl]-6-hydroxybenzoic acid

2-[2,3-bis(methoxycarbonyl)azepin-1-yl]-6-hydroxybenzoic acid (PubChem CID 168650283) has the molecular formula C17H15NO7 and a molecular weight of 345.31 g/mol. Its IUPAC name is 2-[2,3-bis(methoxycarbonyl)azepin-1-yl]-6-hydroxybenzoic acid.

Molecular Properties

Compound Name2-[2,3-bis(methoxycarbonyl)azepin-1-yl]-6-hydroxybenzoic acid
PubChem CID168650283
Molecular FormulaC17H15NO7
Molecular Weight345.31 g/mol
Exact Mass345.08
IUPAC Name2-[2,3-bis(methoxycarbonyl)azepin-1-yl]-6-hydroxybenzoic acid
SMILESCOC(=O)C1=C(C(=O)OC)N(c2cccc(O)c2C(=O)O)C=CC=C1
InChIInChI=1S/C17H15NO7/c1-24-16(22)10-6-3-4-9-18(14(10)17(23)25-2)11-7-5-8-12(19)13(11)15(20)21/h3-9,19H,1-2H3,(H,20,21)
InChIKeyCGFWCPGROQJQTD-UHFFFAOYSA-N
XLogP1.58
TPSA113.37 Ų
H-Bond Donors2
H-Bond Acceptors7
Rotatable Bonds4
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500345.31
LogP ≤ 51.58
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 107

Analyze 2-[2,3-bis(methoxycarbonyl)azepin-1-yl]-6-hydroxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2,3-bis(methoxycarbonyl)azepin-1-yl]-6-hydroxybenzoic acid?
The IUPAC name of 2-[2,3-bis(methoxycarbonyl)azepin-1-yl]-6-hydroxybenzoic acid (CID 168650283) is 2-[2,3-bis(methoxycarbonyl)azepin-1-yl]-6-hydroxybenzoic acid.
What is the SMILES notation for 2-[2,3-bis(methoxycarbonyl)azepin-1-yl]-6-hydroxybenzoic acid?
The canonical SMILES for 2-[2,3-bis(methoxycarbonyl)azepin-1-yl]-6-hydroxybenzoic acid is COC(=O)C1=C(C(=O)OC)N(c2cccc(O)c2C(=O)O)C=CC=C1.
What is the InChIKey of 2-[2,3-bis(methoxycarbonyl)azepin-1-yl]-6-hydroxybenzoic acid?
The InChIKey is CGFWCPGROQJQTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NO7/c1-24-16(22)10-6-3-4-9-18(14(10)17(23)25-2)11-7-5-8-12(19)13(11)15(20)21/h3-9,19H,1-2H3,(H,20,21).
What are the key properties of 2-[2,3-bis(methoxycarbonyl)azepin-1-yl]-6-hydroxybenzoic acid?
2-[2,3-bis(methoxycarbonyl)azepin-1-yl]-6-hydroxybenzoic acid has a molecular weight of 345.31 g/mol, XLogP of 1.58, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,3-bis(methoxycarbonyl)azepin-1-yl]-6-hydroxybenzoic acid is sourced from PubChem (CID 168650283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).