C17H15NO7 — CID 168650283
2-[2,3-bis(methoxycarbonyl)azepin-1-yl]-6-hydroxybenzoic acid (PubChem CID 168650283) has the molecular formula C17H15NO7 and a molecular weight of 345.31 g/mol. Its IUPAC name is 2-[2,3-bis(methoxycarbonyl)azepin-1-yl]-6-hydroxybenzoic acid.
| Compound Name | 2-[2,3-bis(methoxycarbonyl)azepin-1-yl]-6-hydroxybenzoic acid |
|---|---|
| PubChem CID | 168650283 |
| Molecular Formula | C17H15NO7 |
| Molecular Weight | 345.31 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 2-[2,3-bis(methoxycarbonyl)azepin-1-yl]-6-hydroxybenzoic acid |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cccc(O)c2C(=O)O)C=CC=C1 |
| InChI | InChI=1S/C17H15NO7/c1-24-16(22)10-6-3-4-9-18(14(10)17(23)25-2)11-7-5-8-12(19)13(11)15(20)21/h3-9,19H,1-2H3,(H,20,21) |
| InChIKey | CGFWCPGROQJQTD-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.31 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |