C16H14BrNO4 — CID 168646179
dimethyl 1-(2-bromophenyl)azepine-2,3-dicarboxylate (PubChem CID 168646179) has the molecular formula C16H14BrNO4 and a molecular weight of 364.20 g/mol. Its IUPAC name is dimethyl 1-(2-bromophenyl)azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-(2-bromophenyl)azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168646179 |
| Molecular Formula | C16H14BrNO4 |
| Molecular Weight | 364.20 g/mol |
| Exact Mass | 363.01 |
| IUPAC Name | dimethyl 1-(2-bromophenyl)azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccccc2Br)C=CC=C1 |
| InChI | InChI=1S/C16H14BrNO4/c1-21-15(19)11-7-5-6-10-18(14(11)16(20)22-2)13-9-4-3-8-12(13)17/h3-10H,1-2H3 |
| InChIKey | ZCNFKCIGGPLIJH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.20 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |