C18H18N2O5 — CID 168646098
dimethyl 1-(2-acetamidophenyl)azepine-2,3-dicarboxylate (PubChem CID 168646098) has the molecular formula C18H18N2O5 and a molecular weight of 342.35 g/mol. Its IUPAC name is dimethyl 1-(2-acetamidophenyl)azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-(2-acetamidophenyl)azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168646098 |
| Molecular Formula | C18H18N2O5 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | dimethyl 1-(2-acetamidophenyl)azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccccc2NC(C)=O)C=CC=C1 |
| InChI | InChI=1S/C18H18N2O5/c1-12(21)19-14-9-4-5-10-15(14)20-11-7-6-8-13(17(22)24-2)16(20)18(23)25-3/h4-11H,1-3H3,(H,19,21) |
| InChIKey | JSCTUEGFCOAYLC-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |