C22H17F2NO4 — CID 168650129
dimethyl 1-[2-(3,5-difluorophenyl)phenyl]azepine-2,3-dicarboxylate (PubChem CID 168650129) has the molecular formula C22H17F2NO4 and a molecular weight of 397.38 g/mol. Its IUPAC name is dimethyl 1-[2-(3,5-difluorophenyl)phenyl]azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-[2-(3,5-difluorophenyl)phenyl]azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168650129 |
| Molecular Formula | C22H17F2NO4 |
| Molecular Weight | 397.38 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | dimethyl 1-[2-(3,5-difluorophenyl)phenyl]azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccccc2-c2cc(F)cc(F)c2)C=CC=C1 |
| InChI | InChI=1S/C22H17F2NO4/c1-28-21(26)18-8-5-6-10-25(20(18)22(27)29-2)19-9-4-3-7-17(19)14-11-15(23)13-16(24)12-14/h3-13H,1-2H3 |
| InChIKey | PQROHPYEUXHZFP-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.38 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |