C17H14FNO6 — CID 168650664
2-[2,3-bis(methoxycarbonyl)azepin-1-yl]-5-fluorobenzoic acid (PubChem CID 168650664) has the molecular formula C17H14FNO6 and a molecular weight of 347.30 g/mol. Its IUPAC name is 2-[2,3-bis(methoxycarbonyl)azepin-1-yl]-5-fluorobenzoic acid.
| Compound Name | 2-[2,3-bis(methoxycarbonyl)azepin-1-yl]-5-fluorobenzoic acid |
|---|---|
| PubChem CID | 168650664 |
| Molecular Formula | C17H14FNO6 |
| Molecular Weight | 347.30 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 2-[2,3-bis(methoxycarbonyl)azepin-1-yl]-5-fluorobenzoic acid |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(F)cc2C(=O)O)C=CC=C1 |
| InChI | InChI=1S/C17H14FNO6/c1-24-16(22)11-5-3-4-8-19(14(11)17(23)25-2)13-7-6-10(18)9-12(13)15(20)21/h3-9H,1-2H3,(H,20,21) |
| InChIKey | NJASJWPZHHLFGV-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |