C19H20FNO6 — CID 168650628
dimethyl 1-[4-(dimethoxymethyl)-2-fluorophenyl]azepine-2,3-dicarboxylate (PubChem CID 168650628) has the molecular formula C19H20FNO6 and a molecular weight of 377.37 g/mol. Its IUPAC name is dimethyl 1-[4-(dimethoxymethyl)-2-fluorophenyl]azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-[4-(dimethoxymethyl)-2-fluorophenyl]azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168650628 |
| Molecular Formula | C19H20FNO6 |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | dimethyl 1-[4-(dimethoxymethyl)-2-fluorophenyl]azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(C(OC)OC)cc2F)C=CC=C1 |
| InChI | InChI=1S/C19H20FNO6/c1-24-17(22)13-7-5-6-10-21(16(13)18(23)25-2)15-9-8-12(11-14(15)20)19(26-3)27-4/h5-11,19H,1-4H3 |
| InChIKey | ABQQBQFLGMONLT-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|