C16H13F2NO4 — CID 168650547
dimethyl 1-(3,5-difluorophenyl)azepine-2,3-dicarboxylate (PubChem CID 168650547) has the molecular formula C16H13F2NO4 and a molecular weight of 321.28 g/mol. Its IUPAC name is dimethyl 1-(3,5-difluorophenyl)azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-(3,5-difluorophenyl)azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168650547 |
| Molecular Formula | C16H13F2NO4 |
| Molecular Weight | 321.28 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | dimethyl 1-(3,5-difluorophenyl)azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cc(F)cc(F)c2)C=CC=C1 |
| InChI | InChI=1S/C16H13F2NO4/c1-22-15(20)13-5-3-4-6-19(14(13)16(21)23-2)12-8-10(17)7-11(18)9-12/h3-9H,1-2H3 |
| InChIKey | LOWDCQWYPPPUNG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.28 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |