C20H18F6N2O4 — CID 168649692
dimethyl 1-[4-(dimethylamino)-3,5-bis(trifluoromethyl)phenyl]azepine-2,3-dicarboxylate (PubChem CID 168649692) has the molecular formula C20H18F6N2O4 and a molecular weight of 464.36 g/mol. Its IUPAC name is dimethyl 1-[4-(dimethylamino)-3,5-bis(trifluoromethyl)phenyl]azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-[4-(dimethylamino)-3,5-bis(trifluoromethyl)phenyl]azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168649692 |
| Molecular Formula | C20H18F6N2O4 |
| Molecular Weight | 464.36 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | dimethyl 1-[4-(dimethylamino)-3,5-bis(trifluoromethyl)phenyl]azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cc(C(F)(F)F)c(N(C)C)c(C(F)(F)F)c2)C=CC=C1 |
| InChI | InChI=1S/C20H18F6N2O4/c1-27(2)16-13(19(21,22)23)9-11(10-14(16)20(24,25)26)28-8-6-5-7-12(17(29)31-3)15(28)18(30)32-4/h5-10H,1-4H3 |
| InChIKey | OGZYRFIVYGNXRM-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.36 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|