C18H13F6NO4 — CID 168650491
dimethyl 1-[3,5-bis(trifluoromethyl)phenyl]azepine-2,3-dicarboxylate (PubChem CID 168650491) has the molecular formula C18H13F6NO4 and a molecular weight of 421.29 g/mol. Its IUPAC name is dimethyl 1-[3,5-bis(trifluoromethyl)phenyl]azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-[3,5-bis(trifluoromethyl)phenyl]azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168650491 |
| Molecular Formula | C18H13F6NO4 |
| Molecular Weight | 421.29 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | dimethyl 1-[3,5-bis(trifluoromethyl)phenyl]azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)C=CC=C1 |
| InChI | InChI=1S/C18H13F6NO4/c1-28-15(26)13-5-3-4-6-25(14(13)16(27)29-2)12-8-10(17(19,20)21)7-11(9-12)18(22,23)24/h3-9H,1-2H3 |
| InChIKey | RPOLGFRAHMPYOY-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.29 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |