C18H15F4NO5 — CID 168646272
dimethyl 1-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]azepine-2,3-dicarboxylate (PubChem CID 168646272) has the molecular formula C18H15F4NO5 and a molecular weight of 401.31 g/mol. Its IUPAC name is dimethyl 1-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168646272 |
| Molecular Formula | C18H15F4NO5 |
| Molecular Weight | 401.31 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | dimethyl 1-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(OC(F)(F)C(F)F)cc2)C=CC=C1 |
| InChI | InChI=1S/C18H15F4NO5/c1-26-15(24)13-5-3-4-10-23(14(13)16(25)27-2)11-6-8-12(9-7-11)28-18(21,22)17(19)20/h3-10,17H,1-2H3 |
| InChIKey | KHFSEOUGPSTXAU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.31 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|