C16H16N2O6S — CID 168601425
dimethyl 1-(4-sulfamoylphenyl)azepine-2,3-dicarboxylate (PubChem CID 168601425) has the molecular formula C16H16N2O6S and a molecular weight of 364.38 g/mol. Its IUPAC name is dimethyl 1-(4-sulfamoylphenyl)azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-(4-sulfamoylphenyl)azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168601425 |
| Molecular Formula | C16H16N2O6S |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | dimethyl 1-(4-sulfamoylphenyl)azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(S(N)(=O)=O)cc2)C=CC=C1 |
| InChI | InChI=1S/C16H16N2O6S/c1-23-15(19)13-5-3-4-10-18(14(13)16(20)24-2)11-6-8-12(9-7-11)25(17,21)22/h3-10H,1-2H3,(H2,17,21,22) |
| InChIKey | SYZKSCHNXBGGNP-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 116.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |