C21H25NO5 — CID 168648591
dimethyl 1-(4-pentan-3-yloxyphenyl)azepine-2,3-dicarboxylate (PubChem CID 168648591) has the molecular formula C21H25NO5 and a molecular weight of 371.43 g/mol. Its IUPAC name is dimethyl 1-(4-pentan-3-yloxyphenyl)azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-(4-pentan-3-yloxyphenyl)azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168648591 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | dimethyl 1-(4-pentan-3-yloxyphenyl)azepine-2,3-dicarboxylate |
| SMILES | CCC(CC)Oc1ccc(N2C=CC=CC(C(=O)OC)=C2C(=O)OC)cc1 |
| InChI | InChI=1S/C21H25NO5/c1-5-16(6-2)27-17-12-10-15(11-13-17)22-14-8-7-9-18(20(23)25-3)19(22)21(24)26-4/h7-14,16H,5-6H2,1-4H3 |
| InChIKey | LBCIDHQRIAINKX-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |