C20H23ClN2O4 — CID 168647218
dimethyl 1-[3-chloro-4-(diethylamino)phenyl]azepine-2,3-dicarboxylate (PubChem CID 168647218) has the molecular formula C20H23ClN2O4 and a molecular weight of 390.87 g/mol. Its IUPAC name is dimethyl 1-[3-chloro-4-(diethylamino)phenyl]azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-[3-chloro-4-(diethylamino)phenyl]azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168647218 |
| Molecular Formula | C20H23ClN2O4 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | dimethyl 1-[3-chloro-4-(diethylamino)phenyl]azepine-2,3-dicarboxylate |
| SMILES | CCN(CC)c1ccc(N2C=CC=CC(C(=O)OC)=C2C(=O)OC)cc1Cl |
| InChI | InChI=1S/C20H23ClN2O4/c1-5-22(6-2)17-11-10-14(13-16(17)21)23-12-8-7-9-15(19(24)26-3)18(23)20(25)27-4/h7-13H,5-6H2,1-4H3 |
| InChIKey | OMAOTMFATFXMAN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|