C16H14BCl2NO6 — CID 168648402
[5-[2,3-bis(methoxycarbonyl)azepin-1-yl]-2,4-dichlorophenyl]boronic acid (PubChem CID 168648402) has the molecular formula C16H14BCl2NO6 and a molecular weight of 398.01 g/mol. Its IUPAC name is [5-[2,3-bis(methoxycarbonyl)azepin-1-yl]-2,4-dichlorophenyl]boronic acid.
| Compound Name | [5-[2,3-bis(methoxycarbonyl)azepin-1-yl]-2,4-dichlorophenyl]boronic acid |
|---|---|
| PubChem CID | 168648402 |
| Molecular Formula | C16H14BCl2NO6 |
| Molecular Weight | 398.01 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | [5-[2,3-bis(methoxycarbonyl)azepin-1-yl]-2,4-dichlorophenyl]boronic acid |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cc(B(O)O)c(Cl)cc2Cl)C=CC=C1 |
| InChI | InChI=1S/C16H14BCl2NO6/c1-25-15(21)9-5-3-4-6-20(14(9)16(22)26-2)13-7-10(17(23)24)11(18)8-12(13)19/h3-8,23-24H,1-2H3 |
| InChIKey | UJXJRNXAFWAMMM-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.01 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|