C17H12ClF3INO4 — CID 168647363
dimethyl 1-[4-chloro-2-iodo-5-(trifluoromethyl)phenyl]azepine-2,3-dicarboxylate (PubChem CID 168647363) has the molecular formula C17H12ClF3INO4 and a molecular weight of 513.64 g/mol. Its IUPAC name is dimethyl 1-[4-chloro-2-iodo-5-(trifluoromethyl)phenyl]azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-[4-chloro-2-iodo-5-(trifluoromethyl)phenyl]azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168647363 |
| Molecular Formula | C17H12ClF3INO4 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 512.95 |
| IUPAC Name | dimethyl 1-[4-chloro-2-iodo-5-(trifluoromethyl)phenyl]azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cc(C(F)(F)F)c(Cl)cc2I)C=CC=C1 |
| InChI | InChI=1S/C17H12ClF3INO4/c1-26-15(24)9-5-3-4-6-23(14(9)16(25)27-2)13-7-10(17(19,20)21)11(18)8-12(13)22/h3-8H,1-2H3 |
| InChIKey | XZWYSMHTXQBLEF-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|