C16H13Cl2NO7S — CID 168650390
4-[2,3-bis(methoxycarbonyl)azepin-1-yl]-2,5-dichlorobenzenesulfonic acid (PubChem CID 168650390) has the molecular formula C16H13Cl2NO7S and a molecular weight of 434.25 g/mol. Its IUPAC name is 4-[2,3-bis(methoxycarbonyl)azepin-1-yl]-2,5-dichlorobenzenesulfonic acid.
| Compound Name | 4-[2,3-bis(methoxycarbonyl)azepin-1-yl]-2,5-dichlorobenzenesulfonic acid |
|---|---|
| PubChem CID | 168650390 |
| Molecular Formula | C16H13Cl2NO7S |
| Molecular Weight | 434.25 g/mol |
| Exact Mass | 432.98 |
| IUPAC Name | 4-[2,3-bis(methoxycarbonyl)azepin-1-yl]-2,5-dichlorobenzenesulfonic acid |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cc(Cl)c(S(=O)(=O)O)cc2Cl)C=CC=C1 |
| InChI | InChI=1S/C16H13Cl2NO7S/c1-25-15(20)9-5-3-4-6-19(14(9)16(21)26-2)12-7-11(18)13(8-10(12)17)27(22,23)24/h3-8H,1-2H3,(H,22,23,24) |
| InChIKey | RYFUIGCIUQTRJU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.25 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|